About 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide
3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide (PubChem CID 79222743) has the molecular formula C16H25N3S
and a molecular weight of 291.46 g/mol. Its IUPAC name is 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide.
Molecular Properties
| Compound Name | 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide |
| PubChem CID | 79222743 |
| Molecular Formula | C16H25N3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(CC(C)C)CC1Cc2ccccc2S1 |
| InChI | InChI=1S/C16H25N3S/c1-12(2)10-19(8-7-16(17)18)11-14-9-13-5-3-4-6-15(13)20-14/h3-6,12,14H,7-11H2,1-2H3,(H3,17,18) |
| InChIKey | NBHLIPQFPPTLQS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide?
The IUPAC name of 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide (CID 79222743) is 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide.
What is the SMILES notation for 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide?
The canonical SMILES for 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide is [H]/N=C(\N)CCN(CC(C)C)CC1Cc2ccccc2S1.
What is the InChIKey of 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide?
The InChIKey is NBHLIPQFPPTLQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3S/c1-12(2)10-19(8-7-16(17)18)11-14-9-13-5-3-4-6-15(13)20-14/h3-6,12,14H,7-11H2,1-2H3,(H3,17,18).
What are the key properties of 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide?
3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide has a molecular weight of 291.46 g/mol, XLogP of 2.99, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3-dihydro-1-benzothiophen-2-ylmethyl(2-methylpropyl)amino]propanimidamide is sourced from PubChem (CID 79222743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).