C15H22OS — CID 79223958
[1-(2-phenylsulfanylethyl)cyclohexyl]methanol (PubChem CID 79223958) has the molecular formula C15H22OS and a molecular weight of 250.41 g/mol. Its IUPAC name is [1-(2-phenylsulfanylethyl)cyclohexyl]methanol.
| Compound Name | [1-(2-phenylsulfanylethyl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 79223958 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | [1-(2-phenylsulfanylethyl)cyclohexyl]methanol |
| SMILES | OCC1(CCSc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C15H22OS/c16-13-15(9-5-2-6-10-15)11-12-17-14-7-3-1-4-8-14/h1,3-4,7-8,16H,2,5-6,9-13H2 |
| InChIKey | HKXNDHQJLAEXTG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |