About [1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine
[1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine (PubChem CID 79224217) has the molecular formula C13H15N3S
and a molecular weight of 245.35 g/mol. Its IUPAC name is [1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine |
| PubChem CID | 79224217 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | [1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine |
| SMILES | NCc1ccn(CC2Cc3ccccc3S2)n1 |
| InChI | InChI=1S/C13H15N3S/c14-8-11-5-6-16(15-11)9-12-7-10-3-1-2-4-13(10)17-12/h1-6,12H,7-9,14H2 |
| InChIKey | WOVDZDHNNSWGTP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine?
The IUPAC name of [1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine (CID 79224217) is [1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine.
What is the SMILES notation for [1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine?
The canonical SMILES for [1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine is NCc1ccn(CC2Cc3ccccc3S2)n1.
What is the InChIKey of [1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine?
The InChIKey is WOVDZDHNNSWGTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3S/c14-8-11-5-6-16(15-11)9-12-7-10-3-1-2-4-13(10)17-12/h1-6,12H,7-9,14H2.
What are the key properties of [1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine?
[1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine has a molecular weight of 245.35 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazol-3-yl]methanamine is sourced from PubChem (CID 79224217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).