About 6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione
6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione (PubChem CID 79224358) has the molecular formula C14H18N2O2S
and a molecular weight of 278.38 g/mol. Its IUPAC name is 6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione |
| PubChem CID | 79224358 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione |
| SMILES | CC1(C)C(=O)NCC(=O)N1CCSc1ccccc1 |
| InChI | InChI=1S/C14H18N2O2S/c1-14(2)13(18)15-10-12(17)16(14)8-9-19-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3,(H,15,18) |
| InChIKey | ZOFVJLFBLAUKAV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione?
The IUPAC name of 6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione (CID 79224358) is 6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione.
What is the SMILES notation for 6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione?
The canonical SMILES for 6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione is CC1(C)C(=O)NCC(=O)N1CCSc1ccccc1.
What is the InChIKey of 6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione?
The InChIKey is ZOFVJLFBLAUKAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2S/c1-14(2)13(18)15-10-12(17)16(14)8-9-19-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3,(H,15,18).
What are the key properties of 6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione?
6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione has a molecular weight of 278.38 g/mol, XLogP of 1.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-1-(2-phenylsulfanylethyl)piperazine-2,5-dione is sourced from PubChem (CID 79224358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).