About 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine
3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine (PubChem CID 79224848) has the molecular formula C14H18BrN3
and a molecular weight of 308.22 g/mol. Its IUPAC name is 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine |
| PubChem CID | 79224848 |
| Molecular Formula | C14H18BrN3 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine |
| SMILES | Cc1nn(-c2ccccc2Br)c(C)c1CCCN |
| InChI | InChI=1S/C14H18BrN3/c1-10-12(6-5-9-16)11(2)18(17-10)14-8-4-3-7-13(14)15/h3-4,7-8H,5-6,9,16H2,1-2H3 |
| InChIKey | SEBKFMOJFWAFBO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine?
The IUPAC name of 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine (CID 79224848) is 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine.
What is the SMILES notation for 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine?
The canonical SMILES for 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine is Cc1nn(-c2ccccc2Br)c(C)c1CCCN.
What is the InChIKey of 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine?
The InChIKey is SEBKFMOJFWAFBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrN3/c1-10-12(6-5-9-16)11(2)18(17-10)14-8-4-3-7-13(14)15/h3-4,7-8H,5-6,9,16H2,1-2H3.
What are the key properties of 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine?
3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine has a molecular weight of 308.22 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]propan-1-amine is sourced from PubChem (CID 79224848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).