About 2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine
2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine (PubChem CID 79225870) has the molecular formula C12H23N3O2S
and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | 2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine |
| PubChem CID | 79225870 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine |
| SMILES | CNCC(C)c1c(C)nn(CCS(C)(=O)=O)c1C |
| InChI | InChI=1S/C12H23N3O2S/c1-9(8-13-4)12-10(2)14-15(11(12)3)6-7-18(5,16)17/h9,13H,6-8H2,1-5H3 |
| InChIKey | PSHDXYOXECKQOH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine?
The IUPAC name of 2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine (CID 79225870) is 2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine.
What is the SMILES notation for 2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine?
The canonical SMILES for 2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine is CNCC(C)c1c(C)nn(CCS(C)(=O)=O)c1C.
What is the InChIKey of 2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine?
The InChIKey is PSHDXYOXECKQOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O2S/c1-9(8-13-4)12-10(2)14-15(11(12)3)6-7-18(5,16)17/h9,13H,6-8H2,1-5H3.
What are the key properties of 2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine?
2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine has a molecular weight of 273.40 g/mol, XLogP of 0.87, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazol-4-yl]-N-methylpropan-1-amine is sourced from PubChem (CID 79225870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).