C13H16N2O — CID 79226604
2-[2,3-dihydro-1-benzofuran-3-ylmethyl(ethyl)amino]acetonitrile (PubChem CID 79226604) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[2,3-dihydro-1-benzofuran-3-ylmethyl(ethyl)amino]acetonitrile.
| Compound Name | 2-[2,3-dihydro-1-benzofuran-3-ylmethyl(ethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 79226604 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-[2,3-dihydro-1-benzofuran-3-ylmethyl(ethyl)amino]acetonitrile |
| SMILES | CCN(CC#N)CC1COc2ccccc21 |
| InChI | InChI=1S/C13H16N2O/c1-2-15(8-7-14)9-11-10-16-13-6-4-3-5-12(11)13/h3-6,11H,2,8-10H2,1H3 |
| InChIKey | HMYRMVYEDIQTTR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|