C13H19NO2S — CID 79227310
2-[2-phenylsulfanylethyl(propyl)amino]acetic acid (PubChem CID 79227310) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-[2-phenylsulfanylethyl(propyl)amino]acetic acid.
| Compound Name | 2-[2-phenylsulfanylethyl(propyl)amino]acetic acid |
|---|---|
| PubChem CID | 79227310 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-[2-phenylsulfanylethyl(propyl)amino]acetic acid |
| SMILES | CCCN(CCSc1ccccc1)CC(=O)O |
| InChI | InChI=1S/C13H19NO2S/c1-2-8-14(11-13(15)16)9-10-17-12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H,15,16) |
| InChIKey | LBNOMCMHMULYNY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |