C16H14FNO2S — CID 79227476
2,3-dihydro-1-benzothiophen-2-ylmethyl 5-amino-2-fluorobenzoate (PubChem CID 79227476) has the molecular formula C16H14FNO2S and a molecular weight of 303.36 g/mol. Its IUPAC name is 2,3-dihydro-1-benzothiophen-2-ylmethyl 5-amino-2-fluorobenzoate.
| Compound Name | 2,3-dihydro-1-benzothiophen-2-ylmethyl 5-amino-2-fluorobenzoate |
|---|---|
| PubChem CID | 79227476 |
| Molecular Formula | C16H14FNO2S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2,3-dihydro-1-benzothiophen-2-ylmethyl 5-amino-2-fluorobenzoate |
| SMILES | Nc1ccc(F)c(C(=O)OCC2Cc3ccccc3S2)c1 |
| InChI | InChI=1S/C16H14FNO2S/c17-14-6-5-11(18)8-13(14)16(19)20-9-12-7-10-3-1-2-4-15(10)21-12/h1-6,8,12H,7,9,18H2 |
| InChIKey | NTKXWMDTQOHLIH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|