C11H13N3OS — CID 79228386
[2-(2-phenylsulfanylethyl)-1,2,4-triazol-3-yl]methanol (PubChem CID 79228386) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is [2-(2-phenylsulfanylethyl)-1,2,4-triazol-3-yl]methanol.
| Compound Name | [2-(2-phenylsulfanylethyl)-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 79228386 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | [2-(2-phenylsulfanylethyl)-1,2,4-triazol-3-yl]methanol |
| SMILES | OCc1ncnn1CCSc1ccccc1 |
| InChI | InChI=1S/C11H13N3OS/c15-8-11-12-9-13-14(11)6-7-16-10-4-2-1-3-5-10/h1-5,9,15H,6-8H2 |
| InChIKey | FCONASJTKXUWEJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |