C13H15N3O2S — CID 79228564
2-phenylsulfanylethyl 2-(4-aminopyrazol-1-yl)acetate (PubChem CID 79228564) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-phenylsulfanylethyl 2-(4-aminopyrazol-1-yl)acetate.
| Compound Name | 2-phenylsulfanylethyl 2-(4-aminopyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 79228564 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-phenylsulfanylethyl 2-(4-aminopyrazol-1-yl)acetate |
| SMILES | Nc1cnn(CC(=O)OCCSc2ccccc2)c1 |
| InChI | InChI=1S/C13H15N3O2S/c14-11-8-15-16(9-11)10-13(17)18-6-7-19-12-4-2-1-3-5-12/h1-5,8-9H,6-7,10,14H2 |
| InChIKey | YQMQGIVVXYOVIA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|