C14H19N5O — CID 79230777
2-[[6-(ethylamino)-2-pyridinyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 79230777) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-[[6-(ethylamino)-2-pyridinyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[[6-(ethylamino)-2-pyridinyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 79230777 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-[[6-(ethylamino)-2-pyridinyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CCNc1cccc(Cn2nc3n(c2=O)CCCC3)n1 |
| InChI | InChI=1S/C14H19N5O/c1-2-15-12-7-5-6-11(16-12)10-19-14(20)18-9-4-3-8-13(18)17-19/h5-7H,2-4,8-10H2,1H3,(H,15,16) |
| InChIKey | ONWOJYOCZMHPLD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |