About N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine
N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine (PubChem CID 79231761) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine |
| PubChem CID | 79231761 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine |
| SMILES | CNc1cccc(CN2CCCOCC2)n1 |
| InChI | InChI=1S/C12H19N3O/c1-13-12-5-2-4-11(14-12)10-15-6-3-8-16-9-7-15/h2,4-5H,3,6-10H2,1H3,(H,13,14) |
| InChIKey | VOZOCACNBGQBPG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine?
The IUPAC name of N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine (CID 79231761) is N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine.
What is the SMILES notation for N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine?
The canonical SMILES for N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine is CNc1cccc(CN2CCCOCC2)n1.
What is the InChIKey of N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine?
The InChIKey is VOZOCACNBGQBPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O/c1-13-12-5-2-4-11(14-12)10-15-6-3-8-16-9-7-15/h2,4-5H,3,6-10H2,1H3,(H,13,14).
What are the key properties of N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine?
N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine has a molecular weight of 221.30 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-(1,4-oxazepan-4-ylmethyl)pyridin-2-amine is sourced from PubChem (CID 79231761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).