C17H20N2O2 — CID 79232010
ethyl 1-(quinolin-4-ylmethyl)pyrrolidine-2-carboxylate (PubChem CID 79232010) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is ethyl 1-(quinolin-4-ylmethyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-(quinolin-4-ylmethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 79232010 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | ethyl 1-(quinolin-4-ylmethyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C17H20N2O2/c1-2-21-17(20)16-8-5-11-19(16)12-13-9-10-18-15-7-4-3-6-14(13)15/h3-4,6-7,9-10,16H,2,5,8,11-12H2,1H3 |
| InChIKey | GDSSZEJQQDYVEC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |