C9H12N4O2 — CID 79232591
3-[(6-hydrazinyl-2-pyridinyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 79232591) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-[(6-hydrazinyl-2-pyridinyl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(6-hydrazinyl-2-pyridinyl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 79232591 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3-[(6-hydrazinyl-2-pyridinyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | NNc1cccc(CN2CCOC2=O)n1 |
| InChI | InChI=1S/C9H12N4O2/c10-12-8-3-1-2-7(11-8)6-13-4-5-15-9(13)14/h1-3H,4-6,10H2,(H,11,12) |
| InChIKey | XLOFKGUCTXHFFR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|