C14H16ClN3O — CID 79232634
[6-[(4-chloro-3,5-dimethylphenoxy)methyl]-2-pyridinyl]hydrazine (PubChem CID 79232634) has the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. Its IUPAC name is [6-[(4-chloro-3,5-dimethylphenoxy)methyl]-2-pyridinyl]hydrazine.
| Compound Name | [6-[(4-chloro-3,5-dimethylphenoxy)methyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 79232634 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [6-[(4-chloro-3,5-dimethylphenoxy)methyl]-2-pyridinyl]hydrazine |
| SMILES | Cc1cc(OCc2cccc(NN)n2)cc(C)c1Cl |
| InChI | InChI=1S/C14H16ClN3O/c1-9-6-12(7-10(2)14(9)15)19-8-11-4-3-5-13(17-11)18-16/h3-7H,8,16H2,1-2H3,(H,17,18) |
| InChIKey | KXULZDIPHDDYDK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|