About N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine
N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine (PubChem CID 79233123) has the molecular formula C15H26N4
and a molecular weight of 262.40 g/mol. Its IUPAC name is N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine.
Molecular Properties
| Compound Name | N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine |
| PubChem CID | 79233123 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine |
| SMILES | CCNc1cccc(CN2CCN(C)C(C)(C)C2)n1 |
| InChI | InChI=1S/C15H26N4/c1-5-16-14-8-6-7-13(17-14)11-19-10-9-18(4)15(2,3)12-19/h6-8H,5,9-12H2,1-4H3,(H,16,17) |
| InChIKey | DJQWINRSCQGNHC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine?
The IUPAC name of N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine (CID 79233123) is N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine.
What is the SMILES notation for N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine?
The canonical SMILES for N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine is CCNc1cccc(CN2CCN(C)C(C)(C)C2)n1.
What is the InChIKey of N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine?
The InChIKey is DJQWINRSCQGNHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N4/c1-5-16-14-8-6-7-13(17-14)11-19-10-9-18(4)15(2,3)12-19/h6-8H,5,9-12H2,1-4H3,(H,16,17).
What are the key properties of N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine?
N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine has a molecular weight of 262.40 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-6-[(3,3,4-trimethylpiperazin-1-yl)methyl]pyridin-2-amine is sourced from PubChem (CID 79233123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).