C15H23N3 — CID 79233144
6-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-N-methylpyridin-2-amine (PubChem CID 79233144) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 6-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-N-methylpyridin-2-amine.
| Compound Name | 6-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 79233144 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 6-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-N-methylpyridin-2-amine |
| SMILES | CNc1cccc(CN2CCCC3CCCC32)n1 |
| InChI | InChI=1S/C15H23N3/c1-16-15-9-3-7-13(17-15)11-18-10-4-6-12-5-2-8-14(12)18/h3,7,9,12,14H,2,4-6,8,10-11H2,1H3,(H,16,17) |
| InChIKey | JLKPEBHIYDVRQV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |