C14H16N6S — CID 79234048
3-pyridin-2-yl-4-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 79234048) has the molecular formula C14H16N6S and a molecular weight of 300.39 g/mol. Its IUPAC name is 3-pyridin-2-yl-4-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-pyridin-2-yl-4-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 79234048 |
| Molecular Formula | C14H16N6S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-pyridin-2-yl-4-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nn(C)c(C)c1Cn1c(-c2ccccn2)n[nH]c1=S |
| InChI | InChI=1S/C14H16N6S/c1-9-11(10(2)19(3)18-9)8-20-13(16-17-14(20)21)12-6-4-5-7-15-12/h4-7H,8H2,1-3H3,(H,17,21) |
| InChIKey | IFECRJZURVYXFD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|