About 1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine
1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine (PubChem CID 792360) has the molecular formula C15H24N2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine.
Molecular Properties
| Compound Name | 1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine |
| PubChem CID | 792360 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine |
| SMILES | CCN1CCN(Cc2ccc(C)cc2C)CC1 |
| InChI | InChI=1S/C15H24N2/c1-4-16-7-9-17(10-8-16)12-15-6-5-13(2)11-14(15)3/h5-6,11H,4,7-10,12H2,1-3H3 |
| InChIKey | QOXVUSZFKHKMBH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine?
The IUPAC name of 1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine (CID 792360) is 1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine.
What is the SMILES notation for 1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine?
The canonical SMILES for 1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine is CCN1CCN(Cc2ccc(C)cc2C)CC1.
What is the InChIKey of 1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine?
The InChIKey is QOXVUSZFKHKMBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2/c1-4-16-7-9-17(10-8-16)12-15-6-5-13(2)11-14(15)3/h5-6,11H,4,7-10,12H2,1-3H3.
What are the key properties of 1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine?
1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine has a molecular weight of 232.37 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dimethylphenyl)methyl]-4-ethylpiperazine is sourced from PubChem (CID 792360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).