About 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea
1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea (PubChem CID 79237486) has the molecular formula C8H13N3OS
and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea.
Molecular Properties
| Compound Name | 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea |
| PubChem CID | 79237486 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea |
| SMILES | Cc1noc(C)c1C(C)NC(N)=S |
| InChI | InChI=1S/C8H13N3OS/c1-4(10-8(9)13)7-5(2)11-12-6(7)3/h4H,1-3H3,(H3,9,10,13) |
| InChIKey | LHTFOIPKRDLZPN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea?
The IUPAC name of 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea (CID 79237486) is 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea.
What is the SMILES notation for 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea?
The canonical SMILES for 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea is Cc1noc(C)c1C(C)NC(N)=S.
What is the InChIKey of 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea?
The InChIKey is LHTFOIPKRDLZPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS/c1-4(10-8(9)13)7-5(2)11-12-6(7)3/h4H,1-3H3,(H3,9,10,13).
What are the key properties of 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea?
1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea has a molecular weight of 199.28 g/mol, XLogP of 1.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylthiourea is sourced from PubChem (CID 79237486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).