About (3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea
(3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea (PubChem CID 79237487) has the molecular formula C7H11N3OS
and a molecular weight of 185.25 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea.
Molecular Properties
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea |
| PubChem CID | 79237487 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea |
| SMILES | Cc1noc(C)c1CNC(N)=S |
| InChI | InChI=1S/C7H11N3OS/c1-4-6(3-9-7(8)12)5(2)11-10-4/h3H2,1-2H3,(H3,8,9,12) |
| InChIKey | AYBWHGFNCGFRPE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea?
The IUPAC name of (3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea (CID 79237487) is (3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea.
What is the SMILES notation for (3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea?
The canonical SMILES for (3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea is Cc1noc(C)c1CNC(N)=S.
What is the InChIKey of (3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea?
The InChIKey is AYBWHGFNCGFRPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3OS/c1-4-6(3-9-7(8)12)5(2)11-10-4/h3H2,1-2H3,(H3,8,9,12).
What are the key properties of (3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea?
(3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea has a molecular weight of 185.25 g/mol, XLogP of 0.62, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethyl-1,2-oxazol-4-yl)methylthiourea is sourced from PubChem (CID 79237487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).