About 6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine
6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine (PubChem CID 79238970) has the molecular formula C8H8N4S2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine |
| PubChem CID | 79238970 |
| Molecular Formula | C8H8N4S2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine |
| SMILES | Nc1cccc(CSc2nncs2)n1 |
| InChI | InChI=1S/C8H8N4S2/c9-7-3-1-2-6(11-7)4-13-8-12-10-5-14-8/h1-3,5H,4H2,(H2,9,11) |
| InChIKey | MTHKLYWAENXUOI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine?
The IUPAC name of 6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine (CID 79238970) is 6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine.
What is the SMILES notation for 6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine?
The canonical SMILES for 6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine is Nc1cccc(CSc2nncs2)n1.
What is the InChIKey of 6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine?
The InChIKey is MTHKLYWAENXUOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4S2/c9-7-3-1-2-6(11-7)4-13-8-12-10-5-14-8/h1-3,5H,4H2,(H2,9,11).
What are the key properties of 6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine?
6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine has a molecular weight of 224.31 g/mol, XLogP of 1.81, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine is sourced from PubChem (CID 79238970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).