C16H21N3 — CID 79240395
4-[(3-methyl-1,4-diazepan-1-yl)methyl]quinoline (PubChem CID 79240395) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 4-[(3-methyl-1,4-diazepan-1-yl)methyl]quinoline.
| Compound Name | 4-[(3-methyl-1,4-diazepan-1-yl)methyl]quinoline |
|---|---|
| PubChem CID | 79240395 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 4-[(3-methyl-1,4-diazepan-1-yl)methyl]quinoline |
| SMILES | CC1CN(Cc2ccnc3ccccc23)CCCN1 |
| InChI | InChI=1S/C16H21N3/c1-13-11-19(10-4-8-17-13)12-14-7-9-18-16-6-3-2-5-15(14)16/h2-3,5-7,9,13,17H,4,8,10-12H2,1H3 |
| InChIKey | GIGGCBJQJMDXIP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |