C20H24N2O6 — CID 7924135
N-(3,4-dipropoxyphenyl)-2-(2-nitrophenoxy)acetamide (PubChem CID 7924135) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-(3,4-dipropoxyphenyl)-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-(3,4-dipropoxyphenyl)-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 7924135 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-(3,4-dipropoxyphenyl)-2-(2-nitrophenoxy)acetamide |
| SMILES | CCCOc1ccc(NC(=O)COc2ccccc2[N+](=O)[O-])cc1OCCC |
| InChI | InChI=1S/C20H24N2O6/c1-3-11-26-18-10-9-15(13-19(18)27-12-4-2)21-20(23)14-28-17-8-6-5-7-16(17)22(24)25/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,21,23) |
| InChIKey | JAPQHAFEPDTGJF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|