C11H21N3O3S — CID 79241633
N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-(ethylamino)ethanesulfonamide (PubChem CID 79241633) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-(ethylamino)ethanesulfonamide.
| Compound Name | N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-(ethylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 79241633 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-(ethylamino)ethanesulfonamide |
| SMILES | CCNCCS(=O)(=O)NC(C)c1c(C)noc1C |
| InChI | InChI=1S/C11H21N3O3S/c1-5-12-6-7-18(15,16)14-9(3)11-8(2)13-17-10(11)4/h9,12,14H,5-7H2,1-4H3 |
| InChIKey | GEHHJNLZKJHSEE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|