About 6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione
6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione (PubChem CID 79241977) has the molecular formula C13H11BrFN3OS
and a molecular weight of 356.22 g/mol. Its IUPAC name is 6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione.
Molecular Properties
| Compound Name | 6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione |
| PubChem CID | 79241977 |
| Molecular Formula | C13H11BrFN3OS |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione |
| SMILES | Cc1noc(C)c1Cn1c(=S)[nH]c2cc(Br)c(F)cc21 |
| InChI | InChI=1S/C13H11BrFN3OS/c1-6-8(7(2)19-17-6)5-18-12-4-10(15)9(14)3-11(12)16-13(18)20/h3-4H,5H2,1-2H3,(H,16,20) |
| InChIKey | BHZJOFRIIAMNCG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione?
The IUPAC name of 6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione (CID 79241977) is 6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione.
What is the SMILES notation for 6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione?
The canonical SMILES for 6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione is Cc1noc(C)c1Cn1c(=S)[nH]c2cc(Br)c(F)cc21.
What is the InChIKey of 6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione?
The InChIKey is BHZJOFRIIAMNCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrFN3OS/c1-6-8(7(2)19-17-6)5-18-12-4-10(15)9(14)3-11(12)16-13(18)20/h3-4H,5H2,1-2H3,(H,16,20).
What are the key properties of 6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione?
6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione has a molecular weight of 356.22 g/mol, XLogP of 4.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione is sourced from PubChem (CID 79241977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).