About N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide
N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide (PubChem CID 79242655) has the molecular formula C12H22N4O2S
and a molecular weight of 286.40 g/mol. Its IUPAC name is N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide.
Molecular Properties
| Compound Name | N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide |
| PubChem CID | 79242655 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1CNS(=O)(=O)C1CCCNC1 |
| InChI | InChI=1S/C12H22N4O2S/c1-9-12(10(2)16(3)15-9)8-14-19(17,18)11-5-4-6-13-7-11/h11,13-14H,4-8H2,1-3H3 |
| InChIKey | DBWHIPKPTRKNRA-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide?
The IUPAC name of N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide (CID 79242655) is N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide.
What is the SMILES notation for N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide?
The canonical SMILES for N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide is Cc1nn(C)c(C)c1CNS(=O)(=O)C1CCCNC1.
What is the InChIKey of N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide?
The InChIKey is DBWHIPKPTRKNRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O2S/c1-9-12(10(2)16(3)15-9)8-14-19(17,18)11-5-4-6-13-7-11/h11,13-14H,4-8H2,1-3H3.
What are the key properties of N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide?
N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide has a molecular weight of 286.40 g/mol, XLogP of 0.21, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperidine-3-sulfonamide is sourced from PubChem (CID 79242655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).