C12H22N4 — CID 79243038
N-[(6-hydrazinyl-2-pyridinyl)methyl]-N,2,2-trimethylpropan-1-amine (PubChem CID 79243038) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is N-[(6-hydrazinyl-2-pyridinyl)methyl]-N,2,2-trimethylpropan-1-amine.
| Compound Name | N-[(6-hydrazinyl-2-pyridinyl)methyl]-N,2,2-trimethylpropan-1-amine |
|---|---|
| PubChem CID | 79243038 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N-[(6-hydrazinyl-2-pyridinyl)methyl]-N,2,2-trimethylpropan-1-amine |
| SMILES | CN(Cc1cccc(NN)n1)CC(C)(C)C |
| InChI | InChI=1S/C12H22N4/c1-12(2,3)9-16(4)8-10-6-5-7-11(14-10)15-13/h5-7H,8-9,13H2,1-4H3,(H,14,15) |
| InChIKey | RSGIUVIYEJQOPX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|