C11H19N3O2 — CID 79243182
2-[2-hydroxyethyl-[[6-(methylamino)-2-pyridinyl]methyl]amino]ethanol (PubChem CID 79243182) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[[6-(methylamino)-2-pyridinyl]methyl]amino]ethanol.
| Compound Name | 2-[2-hydroxyethyl-[[6-(methylamino)-2-pyridinyl]methyl]amino]ethanol |
|---|---|
| PubChem CID | 79243182 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 2-[2-hydroxyethyl-[[6-(methylamino)-2-pyridinyl]methyl]amino]ethanol |
| SMILES | CNc1cccc(CN(CCO)CCO)n1 |
| InChI | InChI=1S/C11H19N3O2/c1-12-11-4-2-3-10(13-11)9-14(5-7-15)6-8-16/h2-4,15-16H,5-9H2,1H3,(H,12,13) |
| InChIKey | PREHPWFDPMGXFX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |