C10H15N3O2S — CID 79243530
6-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]pyridin-2-amine (PubChem CID 79243530) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 6-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]pyridin-2-amine.
| Compound Name | 6-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 79243530 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 6-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]pyridin-2-amine |
| SMILES | Nc1cccc(CN2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C10H15N3O2S/c11-10-3-1-2-9(12-10)8-13-4-6-16(14,15)7-5-13/h1-3H,4-8H2,(H2,11,12) |
| InChIKey | OSFFOJYYDMQYSB-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |