C14H22N4 — CID 79243747
3-[ethyl-[[6-(ethylamino)-2-pyridinyl]methyl]amino]-2-methylpropanenitrile (PubChem CID 79243747) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 3-[ethyl-[[6-(ethylamino)-2-pyridinyl]methyl]amino]-2-methylpropanenitrile.
| Compound Name | 3-[ethyl-[[6-(ethylamino)-2-pyridinyl]methyl]amino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 79243747 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 3-[ethyl-[[6-(ethylamino)-2-pyridinyl]methyl]amino]-2-methylpropanenitrile |
| SMILES | CCNc1cccc(CN(CC)CC(C)C#N)n1 |
| InChI | InChI=1S/C14H22N4/c1-4-16-14-8-6-7-13(17-14)11-18(5-2)10-12(3)9-15/h6-8,12H,4-5,10-11H2,1-3H3,(H,16,17) |
| InChIKey | DTIFSRUYWOCLJY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |