C10H15N3 — CID 79244858
2-[[cyclopropyl(methyl)amino]methyl]pyridin-4-amine (PubChem CID 79244858) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-[[cyclopropyl(methyl)amino]methyl]pyridin-4-amine.
| Compound Name | 2-[[cyclopropyl(methyl)amino]methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 79244858 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2-[[cyclopropyl(methyl)amino]methyl]pyridin-4-amine |
| SMILES | CN(Cc1cc(N)ccn1)C1CC1 |
| InChI | InChI=1S/C10H15N3/c1-13(10-2-3-10)7-9-6-8(11)4-5-12-9/h4-6,10H,2-3,7H2,1H3,(H2,11,12) |
| InChIKey | SGIZDFGFJKEVCT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |