About 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine
2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine (PubChem CID 79244943) has the molecular formula C18H23N3
and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine.
Molecular Properties
| Compound Name | 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine |
| PubChem CID | 79244943 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine |
| SMILES | CCCNc1ccnc(CN2c3ccccc3CC2C)c1 |
| InChI | InChI=1S/C18H23N3/c1-3-9-19-16-8-10-20-17(12-16)13-21-14(2)11-15-6-4-5-7-18(15)21/h4-8,10,12,14H,3,9,11,13H2,1-2H3,(H,19,20) |
| InChIKey | VWPTYJMCJDUUTP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine?
The IUPAC name of 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine (CID 79244943) is 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine.
What is the SMILES notation for 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine?
The canonical SMILES for 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine is CCCNc1ccnc(CN2c3ccccc3CC2C)c1.
What is the InChIKey of 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine?
The InChIKey is VWPTYJMCJDUUTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3/c1-3-9-19-16-8-10-20-17(12-16)13-21-14(2)11-15-6-4-5-7-18(15)21/h4-8,10,12,14H,3,9,11,13H2,1-2H3,(H,19,20).
What are the key properties of 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine?
2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine has a molecular weight of 281.40 g/mol, XLogP of 3.85, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-N-propylpyridin-4-amine is sourced from PubChem (CID 79244943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).