C16H25N3O — CID 79245125
2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)-N-propylpyridin-4-amine (PubChem CID 79245125) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)-N-propylpyridin-4-amine.
| Compound Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)-N-propylpyridin-4-amine |
|---|---|
| PubChem CID | 79245125 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)-N-propylpyridin-4-amine |
| SMILES | CCCNc1ccnc(CN2CCOC3CCCC32)c1 |
| InChI | InChI=1S/C16H25N3O/c1-2-7-17-13-6-8-18-14(11-13)12-19-9-10-20-16-5-3-4-15(16)19/h6,8,11,15-16H,2-5,7,9-10,12H2,1H3,(H,17,18) |
| InChIKey | ROQKRNPBKCFMQG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |