C11H20N4O2 — CID 79248265
4-amino-5-ethyl-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-1H-pyrazole-3-carboxamide (PubChem CID 79248265) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 4-amino-5-ethyl-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-5-ethyl-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 79248265 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 4-amino-5-ethyl-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(=O)N[C@H](CO)C(C)C)c1N |
| InChI | InChI=1S/C11H20N4O2/c1-4-7-9(12)10(15-14-7)11(17)13-8(5-16)6(2)3/h6,8,16H,4-5,12H2,1-3H3,(H,13,17)(H,14,15)/t8-/m1/s1 |
| InChIKey | NMRFQGWXYLDNTJ-MRVPVSSYSA-N |
| XLogP | 0.30 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |