About (2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol
(2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol (PubChem CID 79250376) has the molecular formula C7H15F2NO
and a molecular weight of 167.20 g/mol. Its IUPAC name is (2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol |
| PubChem CID | 79250376 |
| Molecular Formula | C7H15F2NO |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol |
| SMILES | CC(C)[C@@H](CO)NCC(F)F |
| InChI | InChI=1S/C7H15F2NO/c1-5(2)6(4-11)10-3-7(8)9/h5-7,10-11H,3-4H2,1-2H3/t6-/m1/s1 |
| InChIKey | HCJKAMVPTMDUTR-ZCFIWIBFSA-N |
| XLogP | 0.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol?
The IUPAC name of (2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol (CID 79250376) is (2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol.
What is the SMILES notation for (2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol?
The canonical SMILES for (2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol is CC(C)[C@@H](CO)NCC(F)F.
What is the InChIKey of (2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol?
The InChIKey is HCJKAMVPTMDUTR-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H15F2NO/c1-5(2)6(4-11)10-3-7(8)9/h5-7,10-11H,3-4H2,1-2H3/t6-/m1/s1.
What are the key properties of (2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol?
(2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol has a molecular weight of 167.20 g/mol, XLogP of 0.86, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,2-difluoroethylamino)-3-methylbutan-1-ol is sourced from PubChem (CID 79250376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).