C13H21N3 — CID 79251522
2-[(4,4-dimethylpiperidin-1-yl)methyl]pyridin-4-amine (PubChem CID 79251522) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-[(4,4-dimethylpiperidin-1-yl)methyl]pyridin-4-amine.
| Compound Name | 2-[(4,4-dimethylpiperidin-1-yl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 79251522 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2-[(4,4-dimethylpiperidin-1-yl)methyl]pyridin-4-amine |
| SMILES | CC1(C)CCN(Cc2cc(N)ccn2)CC1 |
| InChI | InChI=1S/C13H21N3/c1-13(2)4-7-16(8-5-13)10-12-9-11(14)3-6-15-12/h3,6,9H,4-5,7-8,10H2,1-2H3,(H2,14,15) |
| InChIKey | XLCAOCDJXRDQPW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |