About 4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol
4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol (PubChem CID 792516) has the molecular formula C15H23NO3
and a molecular weight of 265.35 g/mol. Its IUPAC name is 4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol |
| PubChem CID | 792516 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol |
| SMILES | COc1cc(CN2CCCCCC2)cc(OC)c1O |
| InChI | InChI=1S/C15H23NO3/c1-18-13-9-12(10-14(19-2)15(13)17)11-16-7-5-3-4-6-8-16/h9-10,17H,3-8,11H2,1-2H3 |
| InChIKey | GAYIDXLGESKJJC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol?
The IUPAC name of 4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol (CID 792516) is 4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol.
What is the SMILES notation for 4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol?
The canonical SMILES for 4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol is COc1cc(CN2CCCCCC2)cc(OC)c1O.
What is the InChIKey of 4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol?
The InChIKey is GAYIDXLGESKJJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-18-13-9-12(10-14(19-2)15(13)17)11-16-7-5-3-4-6-8-16/h9-10,17H,3-8,11H2,1-2H3.
What are the key properties of 4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol?
4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol has a molecular weight of 265.35 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azepan-1-ylmethyl)-2,6-dimethoxyphenol is sourced from PubChem (CID 792516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).