C12H13IN4O — CID 79251903
5-iodo-2-methyl-3-[[4-(methylamino)-2-pyridinyl]methyl]pyrimidin-4-one (PubChem CID 79251903) has the molecular formula C12H13IN4O and a molecular weight of 356.17 g/mol. Its IUPAC name is 5-iodo-2-methyl-3-[[4-(methylamino)-2-pyridinyl]methyl]pyrimidin-4-one.
| Compound Name | 5-iodo-2-methyl-3-[[4-(methylamino)-2-pyridinyl]methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 79251903 |
| Molecular Formula | C12H13IN4O |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 5-iodo-2-methyl-3-[[4-(methylamino)-2-pyridinyl]methyl]pyrimidin-4-one |
| SMILES | CNc1ccnc(Cn2c(C)ncc(I)c2=O)c1 |
| InChI | InChI=1S/C12H13IN4O/c1-8-16-6-11(13)12(18)17(8)7-10-5-9(14-2)3-4-15-10/h3-6H,7H2,1-2H3,(H,14,15) |
| InChIKey | WHRHPOKHVAVUGS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|