About 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide
2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide (PubChem CID 79252168) has the molecular formula C11H17N3O4
and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide |
| PubChem CID | 79252168 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide |
| SMILES | CC(C)C(CO)NC(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C11H17N3O4/c1-7(2)8(6-15)12-10(17)5-14-11(18)4-3-9(16)13-14/h3-4,7-8,15H,5-6H2,1-2H3,(H,12,17)(H,13,16) |
| InChIKey | NHMYVVFEWNBJIY-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide?
The IUPAC name of 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide (CID 79252168) is 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide.
What is the SMILES notation for 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide?
The canonical SMILES for 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide is CC(C)C(CO)NC(=O)Cn1[nH]c(=O)ccc1=O.
What is the InChIKey of 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide?
The InChIKey is NHMYVVFEWNBJIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O4/c1-7(2)8(6-15)12-10(17)5-14-11(18)4-3-9(16)13-14/h3-4,7-8,15H,5-6H2,1-2H3,(H,12,17)(H,13,16).
What are the key properties of 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide?
2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide has a molecular weight of 255.27 g/mol, XLogP of -1.33, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide is sourced from PubChem (CID 79252168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).