C14H23NO2 — CID 79253947
2-[1-[(1-hydroxy-3-methylbutan-2-yl)amino]ethyl]-5-methylphenol (PubChem CID 79253947) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 2-[1-[(1-hydroxy-3-methylbutan-2-yl)amino]ethyl]-5-methylphenol.
| Compound Name | 2-[1-[(1-hydroxy-3-methylbutan-2-yl)amino]ethyl]-5-methylphenol |
|---|---|
| PubChem CID | 79253947 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 2-[1-[(1-hydroxy-3-methylbutan-2-yl)amino]ethyl]-5-methylphenol |
| SMILES | Cc1ccc(C(C)NC(CO)C(C)C)c(O)c1 |
| InChI | InChI=1S/C14H23NO2/c1-9(2)13(8-16)15-11(4)12-6-5-10(3)7-14(12)17/h5-7,9,11,13,15-17H,8H2,1-4H3 |
| InChIKey | XBYBEHYHDZTCFY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|