About (2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol
(2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol (PubChem CID 79254185) has the molecular formula C12H22N2OS
and a molecular weight of 242.39 g/mol. Its IUPAC name is (2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol |
| PubChem CID | 79254185 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol |
| SMILES | Cc1nc(C(C)N[C@H](CO)C(C)C)c(C)s1 |
| InChI | InChI=1S/C12H22N2OS/c1-7(2)11(6-15)13-8(3)12-9(4)16-10(5)14-12/h7-8,11,13,15H,6H2,1-5H3/t8?,11-/m1/s1 |
| InChIKey | JHCMRRONJRGDAY-QHDYGNBISA-N |
| XLogP | 2.43 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol?
The IUPAC name of (2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol (CID 79254185) is (2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol.
What is the SMILES notation for (2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol?
The canonical SMILES for (2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol is Cc1nc(C(C)N[C@H](CO)C(C)C)c(C)s1.
What is the InChIKey of (2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol?
The InChIKey is JHCMRRONJRGDAY-QHDYGNBISA-N. The full InChI is InChI=1S/C12H22N2OS/c1-7(2)11(6-15)13-8(3)12-9(4)16-10(5)14-12/h7-8,11,13,15H,6H2,1-5H3/t8?,11-/m1/s1.
What are the key properties of (2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol?
(2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol has a molecular weight of 242.39 g/mol, XLogP of 2.43, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethylamino]-3-methylbutan-1-ol is sourced from PubChem (CID 79254185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).