C16H16INOS — CID 7925479
N-(3-iodo-4-methylphenyl)-2-(2-methylphenyl)sulfanylacetamide (PubChem CID 7925479) has the molecular formula C16H16INOS and a molecular weight of 397.28 g/mol. Its IUPAC name is N-(3-iodo-4-methylphenyl)-2-(2-methylphenyl)sulfanylacetamide.
| Compound Name | N-(3-iodo-4-methylphenyl)-2-(2-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 7925479 |
| Molecular Formula | C16H16INOS |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | N-(3-iodo-4-methylphenyl)-2-(2-methylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)CSc2ccccc2C)cc1I |
| InChI | InChI=1S/C16H16INOS/c1-11-7-8-13(9-14(11)17)18-16(19)10-20-15-6-4-3-5-12(15)2/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | DDDVOLRDCJKNBU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|