About 2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide
2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide (PubChem CID 79256943) has the molecular formula C12H20N4O
and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide |
| PubChem CID | 79256943 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide |
| SMILES | Cc1cc(C)nc(NC(=O)CNC(C)(C)C)n1 |
| InChI | InChI=1S/C12H20N4O/c1-8-6-9(2)15-11(14-8)16-10(17)7-13-12(3,4)5/h6,13H,7H2,1-5H3,(H,14,15,16,17) |
| InChIKey | RBWDSABTXFCRQU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide?
The IUPAC name of 2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide (CID 79256943) is 2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide.
What is the SMILES notation for 2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide?
The canonical SMILES for 2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide is Cc1cc(C)nc(NC(=O)CNC(C)(C)C)n1.
What is the InChIKey of 2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide?
The InChIKey is RBWDSABTXFCRQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O/c1-8-6-9(2)15-11(14-8)16-10(17)7-13-12(3,4)5/h6,13H,7H2,1-5H3,(H,14,15,16,17).
What are the key properties of 2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide?
2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide has a molecular weight of 236.32 g/mol, XLogP of 1.42, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylamino)-N-(4,6-dimethylpyrimidin-2-yl)acetamide is sourced from PubChem (CID 79256943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).