C8H9F3N2O4S — CID 79257967
2-[(2-oxo-1,3-thiazolidine-4-carbonyl)-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79257967) has the molecular formula C8H9F3N2O4S and a molecular weight of 286.23 g/mol. Its IUPAC name is 2-[(2-oxo-1,3-thiazolidine-4-carbonyl)-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[(2-oxo-1,3-thiazolidine-4-carbonyl)-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79257967 |
| Molecular Formula | C8H9F3N2O4S |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-[(2-oxo-1,3-thiazolidine-4-carbonyl)-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(F)(F)F)C(=O)C1CSC(=O)N1 |
| InChI | InChI=1S/C8H9F3N2O4S/c9-8(10,11)3-13(1-5(14)15)6(16)4-2-18-7(17)12-4/h4H,1-3H2,(H,12,17)(H,14,15) |
| InChIKey | CGJIKNJKNAUWJO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|