About 2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid
2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79258059) has the molecular formula C12H20F3NO3
and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid |
| PubChem CID | 79258059 |
| Molecular Formula | C12H20F3NO3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | CCCCC(CC)C(=O)N(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C12H20F3NO3/c1-3-5-6-9(4-2)11(19)16(7-10(17)18)8-12(13,14)15/h9H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | PIFDVTNFNJFKMN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid?
The IUPAC name of 2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid (CID 79258059) is 2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid.
What is the SMILES notation for 2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid?
The canonical SMILES for 2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid is CCCCC(CC)C(=O)N(CC(=O)O)CC(F)(F)F.
What is the InChIKey of 2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid?
The InChIKey is PIFDVTNFNJFKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3NO3/c1-3-5-6-9(4-2)11(19)16(7-10(17)18)8-12(13,14)15/h9H,3-8H2,1-2H3,(H,17,18).
What are the key properties of 2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid?
2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid has a molecular weight of 283.29 g/mol, XLogP of 2.68, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-ethylhexanoyl(2,2,2-trifluoroethyl)amino]acetic acid is sourced from PubChem (CID 79258059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).