C10H12F3N5 — CID 79258844
N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]-2,2,2-trifluoroethanamine (PubChem CID 79258844) has the molecular formula C10H12F3N5 and a molecular weight of 259.23 g/mol. Its IUPAC name is N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 79258844 |
| Molecular Formula | C10H12F3N5 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]-2,2,2-trifluoroethanamine |
| SMILES | Cc1cc(C)n2c(CNCC(F)(F)F)nnc2n1 |
| InChI | InChI=1S/C10H12F3N5/c1-6-3-7(2)18-8(16-17-9(18)15-6)4-14-5-10(11,12)13/h3,14H,4-5H2,1-2H3 |
| InChIKey | ORQDRBUZLRDUFP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |