C10H15F3N2O3 — CID 79258845
2-[[1-oxo-1-(prop-2-enylamino)propan-2-yl]-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79258845) has the molecular formula C10H15F3N2O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is 2-[[1-oxo-1-(prop-2-enylamino)propan-2-yl]-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[[1-oxo-1-(prop-2-enylamino)propan-2-yl]-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79258845 |
| Molecular Formula | C10H15F3N2O3 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-[[1-oxo-1-(prop-2-enylamino)propan-2-yl]-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | C=CCNC(=O)C(C)N(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C10H15F3N2O3/c1-3-4-14-9(18)7(2)15(5-8(16)17)6-10(11,12)13/h3,7H,1,4-6H2,2H3,(H,14,18)(H,16,17) |
| InChIKey | QUZXSJJLEMZXQP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|