C8H10N6S — CID 79259678
[2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-4-pyridinyl]hydrazine (PubChem CID 79259678) has the molecular formula C8H10N6S and a molecular weight of 222.28 g/mol. Its IUPAC name is [2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-4-pyridinyl]hydrazine.
| Compound Name | [2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-4-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 79259678 |
| Molecular Formula | C8H10N6S |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | [2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-4-pyridinyl]hydrazine |
| SMILES | NNc1ccnc(CSc2ncn[nH]2)c1 |
| InChI | InChI=1S/C8H10N6S/c9-13-6-1-2-10-7(3-6)4-15-8-11-5-12-14-8/h1-3,5H,4,9H2,(H,10,13)(H,11,12,14) |
| InChIKey | KVIZQFNEGMEVSK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|